C19H22Cl2FN3O3 — CID 146492930
8-(5-chloro-3-fluoropiperidin-2-yl)-5-[(1S)-1-(4-chlorophenyl)ethyl]-2-oxa-5,8-diazaspiro[3.5]nonane-6,9-dione (PubChem CID 146492930) has the molecular formula C19H22Cl2FN3O3 and a molecular weight of 430.31 g/mol. Its IUPAC name is 8-(5-chloro-3-fluoropiperidin-2-yl)-5-[(1S)-1-(4-chlorophenyl)ethyl]-2-oxa-5,8-diazaspiro[3.5]nonane-6,9-dione.
| Compound Name | 8-(5-chloro-3-fluoropiperidin-2-yl)-5-[(1S)-1-(4-chlorophenyl)ethyl]-2-oxa-5,8-diazaspiro[3.5]nonane-6,9-dione |
|---|---|
| PubChem CID | 146492930 |
| Molecular Formula | C19H22Cl2FN3O3 |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 8-(5-chloro-3-fluoropiperidin-2-yl)-5-[(1S)-1-(4-chlorophenyl)ethyl]-2-oxa-5,8-diazaspiro[3.5]nonane-6,9-dione |
| SMILES | C[C@@H](c1ccc(Cl)cc1)N1C(=O)CN(C2NCC(Cl)CC2F)C(=O)C12COC2 |
| InChI | InChI=1S/C19H22Cl2FN3O3/c1-11(12-2-4-13(20)5-3-12)25-16(26)8-24(18(27)19(25)9-28-10-19)17-15(22)6-14(21)7-23-17/h2-5,11,14-15,17,23H,6-10H2,1H3/t11-,14?,15?,17?/m0/s1 |
| InChIKey | LSJFBSYAIIIFBA-WFVCENDPSA-N |
| XLogP | 2.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|