C14H15ClF3NO4 — CID 146493375
methyl 2-[(2-chloroacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-hydroxypropanoate (PubChem CID 146493375) has the molecular formula C14H15ClF3NO4 and a molecular weight of 353.72 g/mol. Its IUPAC name is methyl 2-[(2-chloroacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-hydroxypropanoate.
| Compound Name | methyl 2-[(2-chloroacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 146493375 |
| Molecular Formula | C14H15ClF3NO4 |
| Molecular Weight | 353.72 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | methyl 2-[(2-chloroacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(C)(O)N(Cc1ccc(C(F)(F)F)cc1)C(=O)CCl |
| InChI | InChI=1S/C14H15ClF3NO4/c1-13(22,12(21)23-2)19(11(20)7-15)8-9-3-5-10(6-4-9)14(16,17)18/h3-6,22H,7-8H2,1-2H3 |
| InChIKey | DPZPABAUONAUAN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.72 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|