C16H22ClN3O2 — CID 146493437
tert-butyl N-[2-(5-chloro-2-cyanoanilino)ethyl]-N-ethylcarbamate (PubChem CID 146493437) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is tert-butyl N-[2-(5-chloro-2-cyanoanilino)ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-(5-chloro-2-cyanoanilino)ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 146493437 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | tert-butyl N-[2-(5-chloro-2-cyanoanilino)ethyl]-N-ethylcarbamate |
| SMILES | CCN(CCNc1cc(Cl)ccc1C#N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22ClN3O2/c1-5-20(15(21)22-16(2,3)4)9-8-19-14-10-13(17)7-6-12(14)11-18/h6-7,10,19H,5,8-9H2,1-4H3 |
| InChIKey | VPQMZFFZQAFZHO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |