About 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde
4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde (PubChem CID 146493665) has the molecular formula C18H13Cl2F3N2O
and a molecular weight of 401.22 g/mol. Its IUPAC name is 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde |
| PubChem CID | 146493665 |
| Molecular Formula | C18H13Cl2F3N2O |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde |
| SMILES | Cc1cc(C(F)(F)F)cc2c1cc(Cc1c(Cl)ncc(C=O)c1Cl)n2C |
| InChI | InChI=1S/C18H13Cl2F3N2O/c1-9-3-11(18(21,22)23)4-15-13(9)5-12(25(15)2)6-14-16(19)10(8-26)7-24-17(14)20/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | MAIVWCNTMDHQSK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde?
The IUPAC name of 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde (CID 146493665) is 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde.
What is the SMILES notation for 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde?
The canonical SMILES for 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde is Cc1cc(C(F)(F)F)cc2c1cc(Cc1c(Cl)ncc(C=O)c1Cl)n2C.
What is the InChIKey of 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde?
The InChIKey is MAIVWCNTMDHQSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2F3N2O/c1-9-3-11(18(21,22)23)4-15-13(9)5-12(25(15)2)6-14-16(19)10(8-26)7-24-17(14)20/h3-5,7-8H,6H2,1-2H3.
What are the key properties of 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde?
4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde has a molecular weight of 401.22 g/mol, XLogP of 5.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-5-[[1,4-dimethyl-6-(trifluoromethyl)indol-2-yl]methyl]pyridine-3-carbaldehyde is sourced from PubChem (CID 146493665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).