C22H25Cl2N3O2 — CID 146493703
N-[2-[2-[3-[(6-amino-1,4-dimethylindol-2-yl)methyl]-2,4-dichlorophenyl]ethoxy]ethyl]formamide (PubChem CID 146493703) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is N-[2-[2-[3-[(6-amino-1,4-dimethylindol-2-yl)methyl]-2,4-dichlorophenyl]ethoxy]ethyl]formamide.
| Compound Name | N-[2-[2-[3-[(6-amino-1,4-dimethylindol-2-yl)methyl]-2,4-dichlorophenyl]ethoxy]ethyl]formamide |
|---|---|
| PubChem CID | 146493703 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[2-[2-[3-[(6-amino-1,4-dimethylindol-2-yl)methyl]-2,4-dichlorophenyl]ethoxy]ethyl]formamide |
| SMILES | Cc1cc(N)cc2c1cc(Cc1c(Cl)ccc(CCOCCNC=O)c1Cl)n2C |
| InChI | InChI=1S/C22H25Cl2N3O2/c1-14-9-16(25)10-21-18(14)11-17(27(21)2)12-19-20(23)4-3-15(22(19)24)5-7-29-8-6-26-13-28/h3-4,9-11,13H,5-8,12,25H2,1-2H3,(H,26,28) |
| InChIKey | HSOUIKKDGPXFGU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|