C22H14Cl2F3N3O2S — CID 146493746
4,6-dichloro-5-[hydroxy-[4-methyl-1-phenylsulfanyl-6-(trifluoromethyl)pyrrolo[2,3-b]pyridin-2-yl]methyl]pyridine-3-carbaldehyde (PubChem CID 146493746) has the molecular formula C22H14Cl2F3N3O2S and a molecular weight of 512.34 g/mol. Its IUPAC name is 4,6-dichloro-5-[hydroxy-[4-methyl-1-phenylsulfanyl-6-(trifluoromethyl)pyrrolo[2,3-b]pyridin-2-yl]methyl]pyridine-3-carbaldehyde.
| Compound Name | 4,6-dichloro-5-[hydroxy-[4-methyl-1-phenylsulfanyl-6-(trifluoromethyl)pyrrolo[2,3-b]pyridin-2-yl]methyl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 146493746 |
| Molecular Formula | C22H14Cl2F3N3O2S |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | 4,6-dichloro-5-[hydroxy-[4-methyl-1-phenylsulfanyl-6-(trifluoromethyl)pyrrolo[2,3-b]pyridin-2-yl]methyl]pyridine-3-carbaldehyde |
| SMILES | Cc1cc(C(F)(F)F)nc2c1cc(C(O)c1c(Cl)ncc(C=O)c1Cl)n2Sc1ccccc1 |
| InChI | InChI=1S/C22H14Cl2F3N3O2S/c1-11-7-16(22(25,26)27)29-21-14(11)8-15(30(21)33-13-5-3-2-4-6-13)19(32)17-18(23)12(10-31)9-28-20(17)24/h2-10,19,32H,1H3 |
| InChIKey | AKVLBNABWWOMAR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|