C18H13Cl2N3O — CID 146493806
2-[(2,6-dichloro-3-formylphenyl)methyl]-1,4-dimethylpyrrolo[2,3-b]pyridine-6-carbonitrile (PubChem CID 146493806) has the molecular formula C18H13Cl2N3O and a molecular weight of 358.23 g/mol. Its IUPAC name is 2-[(2,6-dichloro-3-formylphenyl)methyl]-1,4-dimethylpyrrolo[2,3-b]pyridine-6-carbonitrile.
| Compound Name | 2-[(2,6-dichloro-3-formylphenyl)methyl]-1,4-dimethylpyrrolo[2,3-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 146493806 |
| Molecular Formula | C18H13Cl2N3O |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-[(2,6-dichloro-3-formylphenyl)methyl]-1,4-dimethylpyrrolo[2,3-b]pyridine-6-carbonitrile |
| SMILES | Cc1cc(C#N)nc2c1cc(Cc1c(Cl)ccc(C=O)c1Cl)n2C |
| InChI | InChI=1S/C18H13Cl2N3O/c1-10-5-12(8-21)22-18-14(10)6-13(23(18)2)7-15-16(19)4-3-11(9-24)17(15)20/h3-6,9H,7H2,1-2H3 |
| InChIKey | PHPNZTKYYAMATB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|