C24H26Cl2N4O2 — CID 146493989
N-[5-[2,4-dichloro-3-[(6-cyano-1,4-dimethylbenzimidazol-2-yl)methyl]phenyl]-3-methoxypentyl]formamide (PubChem CID 146493989) has the molecular formula C24H26Cl2N4O2 and a molecular weight of 473.40 g/mol. Its IUPAC name is N-[5-[2,4-dichloro-3-[(6-cyano-1,4-dimethylbenzimidazol-2-yl)methyl]phenyl]-3-methoxypentyl]formamide.
| Compound Name | N-[5-[2,4-dichloro-3-[(6-cyano-1,4-dimethylbenzimidazol-2-yl)methyl]phenyl]-3-methoxypentyl]formamide |
|---|---|
| PubChem CID | 146493989 |
| Molecular Formula | C24H26Cl2N4O2 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[5-[2,4-dichloro-3-[(6-cyano-1,4-dimethylbenzimidazol-2-yl)methyl]phenyl]-3-methoxypentyl]formamide |
| SMILES | COC(CCNC=O)CCc1ccc(Cl)c(Cc2nc3c(C)cc(C#N)cc3n2C)c1Cl |
| InChI | InChI=1S/C24H26Cl2N4O2/c1-15-10-16(13-27)11-21-24(15)29-22(30(21)2)12-19-20(25)7-5-17(23(19)26)4-6-18(32-3)8-9-28-14-31/h5,7,10-11,14,18H,4,6,8-9,12H2,1-3H3,(H,28,31) |
| InChIKey | QCUJMMCVCCVVHG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|