C19H16Cl2F3NO3 — CID 146494096
2,4-dichloro-3-[[3,7-dimethyl-5-(trifluoromethoxy)-2,3-dihydroindol-1-yl]methyl]benzoic acid (PubChem CID 146494096) has the molecular formula C19H16Cl2F3NO3 and a molecular weight of 434.24 g/mol. Its IUPAC name is 2,4-dichloro-3-[[3,7-dimethyl-5-(trifluoromethoxy)-2,3-dihydroindol-1-yl]methyl]benzoic acid.
| Compound Name | 2,4-dichloro-3-[[3,7-dimethyl-5-(trifluoromethoxy)-2,3-dihydroindol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 146494096 |
| Molecular Formula | C19H16Cl2F3NO3 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 2,4-dichloro-3-[[3,7-dimethyl-5-(trifluoromethoxy)-2,3-dihydroindol-1-yl]methyl]benzoic acid |
| SMILES | Cc1cc(OC(F)(F)F)cc2c1N(Cc1c(Cl)ccc(C(=O)O)c1Cl)CC2C |
| InChI | InChI=1S/C19H16Cl2F3NO3/c1-9-5-11(28-19(22,23)24)6-13-10(2)7-25(17(9)13)8-14-15(20)4-3-12(16(14)21)18(26)27/h3-6,10H,7-8H2,1-2H3,(H,26,27) |
| InChIKey | FXAJNXPOZCTJKA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|