About 4-(trifluoromethyl)-3a,4-dihydro-1H-indole
4-(trifluoromethyl)-3a,4-dihydro-1H-indole (PubChem CID 146494442) has the molecular formula C9H8F3N
and a molecular weight of 187.16 g/mol. Its IUPAC name is 4-(trifluoromethyl)-3a,4-dihydro-1H-indole.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)-3a,4-dihydro-1H-indole |
| PubChem CID | 146494442 |
| Molecular Formula | C9H8F3N |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 4-(trifluoromethyl)-3a,4-dihydro-1H-indole |
| SMILES | FC(F)(F)C1C=CC=C2NC=CC21 |
| InChI | InChI=1S/C9H8F3N/c10-9(11,12)7-2-1-3-8-6(7)4-5-13-8/h1-7,13H |
| InChIKey | PDQSTLMYRWYQPI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(trifluoromethyl)-3a,4-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)-3a,4-dihydro-1H-indole?
The IUPAC name of 4-(trifluoromethyl)-3a,4-dihydro-1H-indole (CID 146494442) is 4-(trifluoromethyl)-3a,4-dihydro-1H-indole.
What is the SMILES notation for 4-(trifluoromethyl)-3a,4-dihydro-1H-indole?
The canonical SMILES for 4-(trifluoromethyl)-3a,4-dihydro-1H-indole is FC(F)(F)C1C=CC=C2NC=CC21.
What is the InChIKey of 4-(trifluoromethyl)-3a,4-dihydro-1H-indole?
The InChIKey is PDQSTLMYRWYQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3N/c10-9(11,12)7-2-1-3-8-6(7)4-5-13-8/h1-7,13H.
What are the key properties of 4-(trifluoromethyl)-3a,4-dihydro-1H-indole?
4-(trifluoromethyl)-3a,4-dihydro-1H-indole has a molecular weight of 187.16 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)-3a,4-dihydro-1H-indole is sourced from PubChem (CID 146494442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).