C20H19FN8O2 — CID 146494646
4-[(3R)-3-fluoro-1-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)piperidine-4-carbonyl]-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepine-9-carbonitrile (PubChem CID 146494646) has the molecular formula C20H19FN8O2 and a molecular weight of 422.42 g/mol. Its IUPAC name is 4-[(3R)-3-fluoro-1-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)piperidine-4-carbonyl]-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepine-9-carbonitrile.
| Compound Name | 4-[(3R)-3-fluoro-1-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)piperidine-4-carbonyl]-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepine-9-carbonitrile |
|---|---|
| PubChem CID | 146494646 |
| Molecular Formula | C20H19FN8O2 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-[(3R)-3-fluoro-1-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)piperidine-4-carbonyl]-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepine-9-carbonitrile |
| SMILES | N#Cc1cncc2c1OCCN(C(=O)C1CCN(c3nccn4ncnc34)C[C@@H]1F)C2 |
| InChI | InChI=1S/C20H19FN8O2/c21-16-11-27(18-19-25-12-26-29(19)4-2-24-18)3-1-15(16)20(30)28-5-6-31-17-13(7-22)8-23-9-14(17)10-28/h2,4,8-9,12,15-16H,1,3,5-6,10-11H2/t15?,16-/m0/s1 |
| InChIKey | HYRNRFNEBNKWCB-LYKKTTPLSA-N |
| XLogP | 0.98 |
| TPSA | 112.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |