C13H21N2O3S- — CID 146495917
(2E,3Z,5S,6R)-5-(acetamidomethyl)-2,3-di(ethylidene)-6-methylpiperidine-1-sulfinate (PubChem CID 146495917) has the molecular formula C13H21N2O3S- and a molecular weight of 285.39 g/mol. Its IUPAC name is (2E,3Z,5S,6R)-5-(acetamidomethyl)-2,3-di(ethylidene)-6-methylpiperidine-1-sulfinate.
| Compound Name | (2E,3Z,5S,6R)-5-(acetamidomethyl)-2,3-di(ethylidene)-6-methylpiperidine-1-sulfinate |
|---|---|
| PubChem CID | 146495917 |
| Molecular Formula | C13H21N2O3S- |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (2E,3Z,5S,6R)-5-(acetamidomethyl)-2,3-di(ethylidene)-6-methylpiperidine-1-sulfinate |
| SMILES | C/C=C1/C[C@@H](CNC(C)=O)[C@@H](C)N(S(=O)[O-])/C1=C/C |
| InChI | InChI=1S/C13H22N2O3S/c1-5-11-7-12(8-14-10(4)16)9(3)15(19(17)18)13(11)6-2/h5-6,9,12H,7-8H2,1-4H3,(H,14,16)(H,17,18)/p-1/b11-5-,13-6+/t9-,12+/m1/s1 |
| InChIKey | FVHSRAKNCXFGDY-XHHYMCEDSA-M |
| XLogP | 1.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|