C12H17N2O3S- — CID 146495924
(2E,3Z,5R)-5-acetamido-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate (PubChem CID 146495924) has the molecular formula C12H17N2O3S- and a molecular weight of 269.35 g/mol. Its IUPAC name is (2E,3Z,5R)-5-acetamido-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate.
| Compound Name | (2E,3Z,5R)-5-acetamido-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate |
|---|---|
| PubChem CID | 146495924 |
| Molecular Formula | C12H17N2O3S- |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (2E,3Z,5R)-5-acetamido-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate |
| SMILES | C=C/C=C1/C[C@@H](NC(C)=O)CN(S(=O)[O-])/C1=C/C |
| InChI | InChI=1S/C12H18N2O3S/c1-4-6-10-7-11(13-9(3)15)8-14(18(16)17)12(10)5-2/h4-6,11H,1,7-8H2,2-3H3,(H,13,15)(H,16,17)/p-1/b10-6-,12-5+/t11-/m1/s1 |
| InChIKey | VFSMQJWIPPZJPW-YJCGNGMNSA-M |
| XLogP | 1.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|