C18H29N3O5S — CID 146495944
1-[[(3S,5Z,6E)-5,6-di(ethylidene)-1-sulfinopiperidin-3-yl]methyl-methylcarbamoyl]piperidine-4-carboxylic acid (PubChem CID 146495944) has the molecular formula C18H29N3O5S and a molecular weight of 399.51 g/mol. Its IUPAC name is 1-[[(3S,5Z,6E)-5,6-di(ethylidene)-1-sulfinopiperidin-3-yl]methyl-methylcarbamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[(3S,5Z,6E)-5,6-di(ethylidene)-1-sulfinopiperidin-3-yl]methyl-methylcarbamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 146495944 |
| Molecular Formula | C18H29N3O5S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-[[(3S,5Z,6E)-5,6-di(ethylidene)-1-sulfinopiperidin-3-yl]methyl-methylcarbamoyl]piperidine-4-carboxylic acid |
| SMILES | C/C=C1/C[C@@H](CN(C)C(=O)N2CCC(C(=O)O)CC2)CN(S(=O)O)/C1=C/C |
| InChI | InChI=1S/C18H29N3O5S/c1-4-14-10-13(12-21(27(25)26)16(14)5-2)11-19(3)18(24)20-8-6-15(7-9-20)17(22)23/h4-5,13,15H,6-12H2,1-3H3,(H,22,23)(H,25,26)/b14-4-,16-5+/t13-/m0/s1 |
| InChIKey | FZRIBSNZYYYJET-DHMQPGICSA-N |
| XLogP | 2.14 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|