About methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate
methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate (PubChem CID 146496124) has the molecular formula C9H11N3O4
and a molecular weight of 225.20 g/mol. Its IUPAC name is methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate |
| PubChem CID | 146496124 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate |
| SMILES | COC(=O)c1c2c(c([N+](=O)[O-])n1C)NCC2 |
| InChI | InChI=1S/C9H11N3O4/c1-11-7(9(13)16-2)5-3-4-10-6(5)8(11)12(14)15/h10H,3-4H2,1-2H3 |
| InChIKey | OTOQTUXHJHSZHS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate?
The IUPAC name of methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate (CID 146496124) is methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate.
What is the SMILES notation for methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate?
The canonical SMILES for methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate is COC(=O)c1c2c(c([N+](=O)[O-])n1C)NCC2.
What is the InChIKey of methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate?
The InChIKey is OTOQTUXHJHSZHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O4/c1-11-7(9(13)16-2)5-3-4-10-6(5)8(11)12(14)15/h10H,3-4H2,1-2H3.
What are the key properties of methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate?
methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate has a molecular weight of 225.20 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-6-nitro-2,3-dihydro-1H-pyrrolo[2,3-c]pyrrole-4-carboxylate is sourced from PubChem (CID 146496124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).