C20H25Cl2N5O8P2 — CID 146496801
[[(1R,2R,3S,4R)-4-[6-chloro-4-[[(1S)-1-(2-chlorophenyl)ethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 146496801) has the molecular formula C20H25Cl2N5O8P2 and a molecular weight of 596.30 g/mol. Its IUPAC name is [[(1R,2R,3S,4R)-4-[6-chloro-4-[[(1S)-1-(2-chlorophenyl)ethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(1R,2R,3S,4R)-4-[6-chloro-4-[[(1S)-1-(2-chlorophenyl)ethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 146496801 |
| Molecular Formula | C20H25Cl2N5O8P2 |
| Molecular Weight | 596.30 g/mol |
| Exact Mass | 595.06 |
| IUPAC Name | [[(1R,2R,3S,4R)-4-[6-chloro-4-[[(1S)-1-(2-chlorophenyl)ethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@H](Nc1nc(Cl)nc2c1cnn2[C@@H]1C[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccccc1Cl |
| InChI | InChI=1S/C20H25Cl2N5O8P2/c1-10(12-4-2-3-5-14(12)21)24-18-13-7-23-27(19(13)26-20(22)25-18)15-6-11(16(28)17(15)29)8-35-37(33,34)9-36(30,31)32/h2-5,7,10-11,15-17,28-29H,6,8-9H2,1H3,(H,33,34)(H,24,25,26)(H2,30,31,32)/t10-,11+,15+,16+,17-/m0/s1 |
| InChIKey | NNYUIERHVGBIRR-IIFPJAJBSA-N |
| XLogP | 2.93 |
| TPSA | 200.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|