About 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine
8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine (PubChem CID 146497600) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine.
Molecular Properties
| Compound Name | 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine |
| PubChem CID | 146497600 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine |
| SMILES | CCC1(C)C=CC2=NC(C)(C(C)C)C=CN2C=C1 |
| InChI | InChI=1S/C16H24N2/c1-6-15(4)8-7-14-17-16(5,13(2)3)10-12-18(14)11-9-15/h7-13H,6H2,1-5H3 |
| InChIKey | PDMGMJIFURVLEH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine?
The IUPAC name of 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine (CID 146497600) is 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine.
What is the SMILES notation for 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine?
The canonical SMILES for 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine is CCC1(C)C=CC2=NC(C)(C(C)C)C=CN2C=C1.
What is the InChIKey of 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine?
The InChIKey is PDMGMJIFURVLEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2/c1-6-15(4)8-7-14-17-16(5,13(2)3)10-12-18(14)11-9-15/h7-13H,6H2,1-5H3.
What are the key properties of 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine?
8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine has a molecular weight of 244.38 g/mol, XLogP of 4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-2,8-dimethyl-2-propan-2-ylpyrimido[1,2-a]azepine is sourced from PubChem (CID 146497600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).