About 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine
2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine (PubChem CID 146497984) has the molecular formula C19H19NS
and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine.
Molecular Properties
| Compound Name | 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine |
| PubChem CID | 146497984 |
| Molecular Formula | C19H19NS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine |
| SMILES | CC12CC=CC=C1CC(c1ccc3ccccc3c1N)S2 |
| InChI | InChI=1S/C19H19NS/c1-19-11-5-4-7-14(19)12-17(21-19)16-10-9-13-6-2-3-8-15(13)18(16)20/h2-10,17H,11-12,20H2,1H3 |
| InChIKey | ZIUAQZJRDLFGPP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine?
The IUPAC name of 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine (CID 146497984) is 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine.
What is the SMILES notation for 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine?
The canonical SMILES for 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine is CC12CC=CC=C1CC(c1ccc3ccccc3c1N)S2.
What is the InChIKey of 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine?
The InChIKey is ZIUAQZJRDLFGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NS/c1-19-11-5-4-7-14(19)12-17(21-19)16-10-9-13-6-2-3-8-15(13)18(16)20/h2-10,17H,11-12,20H2,1H3.
What are the key properties of 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine?
2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine has a molecular weight of 293.44 g/mol, XLogP of 5.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7a-methyl-3,7-dihydro-2H-1-benzothiophen-2-yl)naphthalen-1-amine is sourced from PubChem (CID 146497984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).