C45H41N5 — CID 146498005
5-[6-[4-(4a,8a-dihydronaphthalen-2-yl)-6-phenyl-1,3,5-triazinan-2-yl]-1,2-dihydropyridin-3-yl]-7,7-dimethylindeno[2,1-b]carbazole (PubChem CID 146498005) has the molecular formula C45H41N5 and a molecular weight of 651.86 g/mol. Its IUPAC name is 5-[6-[4-(4a,8a-dihydronaphthalen-2-yl)-6-phenyl-1,3,5-triazinan-2-yl]-1,2-dihydropyridin-3-yl]-7,7-dimethylindeno[2,1-b]carbazole.
| Compound Name | 5-[6-[4-(4a,8a-dihydronaphthalen-2-yl)-6-phenyl-1,3,5-triazinan-2-yl]-1,2-dihydropyridin-3-yl]-7,7-dimethylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 146498005 |
| Molecular Formula | C45H41N5 |
| Molecular Weight | 651.86 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | 5-[6-[4-(4a,8a-dihydronaphthalen-2-yl)-6-phenyl-1,3,5-triazinan-2-yl]-1,2-dihydropyridin-3-yl]-7,7-dimethylindeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4ccccc4n(C4=CC=C(C5NC(C6=CC7C=CC=CC7C=C6)NC(c6ccccc6)N5)NC4)c3cc21 |
| InChI | InChI=1S/C45H41N5/c1-45(2)37-18-10-8-16-33(37)35-25-36-34-17-9-11-19-40(34)50(41(36)26-38(35)45)32-22-23-39(46-27-32)44-48-42(29-13-4-3-5-14-29)47-43(49-44)31-21-20-28-12-6-7-15-30(28)24-31/h3-26,28,30,42-44,46-49H,27H2,1-2H3 |
| InChIKey | LRVQXOLRZJZDJG-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.86 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |