C43H31N3O — CID 146498575
4-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-[(2E,4Z)-hexa-2,4-dien-3-yl]-[1]benzofuro[3,2-c]quinoline (PubChem CID 146498575) has the molecular formula C43H31N3O and a molecular weight of 605.74 g/mol. Its IUPAC name is 4-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-[(2E,4Z)-hexa-2,4-dien-3-yl]-[1]benzofuro[3,2-c]quinoline.
| Compound Name | 4-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-[(2E,4Z)-hexa-2,4-dien-3-yl]-[1]benzofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 146498575 |
| Molecular Formula | C43H31N3O |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | 4-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-[(2E,4Z)-hexa-2,4-dien-3-yl]-[1]benzofuro[3,2-c]quinoline |
| SMILES | C/C=C\C(=C/C)c1nc2c(-c3ccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)cc3)cccc2c2oc3ccccc3c12 |
| InChI | InChI=1S/C43H31N3O/c1-3-14-28(4-2)40-39-34-19-11-12-22-38(34)47-42(39)35-21-13-20-33(41(35)46-40)29-23-25-32(26-24-29)43-44-36(30-15-7-5-8-16-30)27-37(45-43)31-17-9-6-10-18-31/h3-27H,1-2H3/b14-3-,28-4+ |
| InChIKey | GLKNKFJXLNINTN-OXFJJTMGSA-N |
| XLogP | 11.57 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|