C12H16N2 — CID 146498779
9b-methyl-1,2,3,4,4a,5-hexahydropyrido[4,3-b]indole (PubChem CID 146498779) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 9b-methyl-1,2,3,4,4a,5-hexahydropyrido[4,3-b]indole.
| Compound Name | 9b-methyl-1,2,3,4,4a,5-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 146498779 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 9b-methyl-1,2,3,4,4a,5-hexahydropyrido[4,3-b]indole |
| SMILES | CC12CNCCC1Nc1ccccc12 |
| InChI | InChI=1S/C12H16N2/c1-12-8-13-7-6-11(12)14-10-5-3-2-4-9(10)12/h2-5,11,13-14H,6-8H2,1H3 |
| InChIKey | WSQKSWYTFNIHRX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |