About 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine
1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine (PubChem CID 146499062) has the molecular formula C5H8FN3O
and a molecular weight of 145.14 g/mol. Its IUPAC name is 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine |
| PubChem CID | 146499062 |
| Molecular Formula | C5H8FN3O |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1noc(F)n1 |
| InChI | InChI=1S/C5H8FN3O/c1-9(2)3-4-7-5(6)10-8-4/h3H2,1-2H3 |
| InChIKey | FZXLYXDTEIUJFG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine (CID 146499062) is 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine is CN(C)Cc1noc(F)n1.
What is the InChIKey of 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine?
The InChIKey is FZXLYXDTEIUJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN3O/c1-9(2)3-4-7-5(6)10-8-4/h3H2,1-2H3.
What are the key properties of 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine?
1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine has a molecular weight of 145.14 g/mol, XLogP of 0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-fluoro-1,2,4-oxadiazol-3-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 146499062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).