About 6-fluoro-1,5-dimethyl-6,7-dihydroindazole
6-fluoro-1,5-dimethyl-6,7-dihydroindazole (PubChem CID 146499106) has the molecular formula C9H11FN2
and a molecular weight of 166.20 g/mol. Its IUPAC name is 6-fluoro-1,5-dimethyl-6,7-dihydroindazole.
Molecular Properties
| Compound Name | 6-fluoro-1,5-dimethyl-6,7-dihydroindazole |
| PubChem CID | 146499106 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 6-fluoro-1,5-dimethyl-6,7-dihydroindazole |
| SMILES | CC1=Cc2cnn(C)c2CC1F |
| InChI | InChI=1S/C9H11FN2/c1-6-3-7-5-11-12(2)9(7)4-8(6)10/h3,5,8H,4H2,1-2H3 |
| InChIKey | ONCWPPXFYZPLRP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-1,5-dimethyl-6,7-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1,5-dimethyl-6,7-dihydroindazole?
The IUPAC name of 6-fluoro-1,5-dimethyl-6,7-dihydroindazole (CID 146499106) is 6-fluoro-1,5-dimethyl-6,7-dihydroindazole.
What is the SMILES notation for 6-fluoro-1,5-dimethyl-6,7-dihydroindazole?
The canonical SMILES for 6-fluoro-1,5-dimethyl-6,7-dihydroindazole is CC1=Cc2cnn(C)c2CC1F.
What is the InChIKey of 6-fluoro-1,5-dimethyl-6,7-dihydroindazole?
The InChIKey is ONCWPPXFYZPLRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2/c1-6-3-7-5-11-12(2)9(7)4-8(6)10/h3,5,8H,4H2,1-2H3.
What are the key properties of 6-fluoro-1,5-dimethyl-6,7-dihydroindazole?
6-fluoro-1,5-dimethyl-6,7-dihydroindazole has a molecular weight of 166.20 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1,5-dimethyl-6,7-dihydroindazole is sourced from PubChem (CID 146499106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).