C10H12FN — CID 146499155
(2Z,4Z,6Z)-3-fluoro-2,5-dimethylocta-2,4,6-trienenitrile (PubChem CID 146499155) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is (2Z,4Z,6Z)-3-fluoro-2,5-dimethylocta-2,4,6-trienenitrile.
| Compound Name | (2Z,4Z,6Z)-3-fluoro-2,5-dimethylocta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 146499155 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (2Z,4Z,6Z)-3-fluoro-2,5-dimethylocta-2,4,6-trienenitrile |
| SMILES | C/C=C\C(C)=C/C(F)=C(\C)C#N |
| InChI | InChI=1S/C10H12FN/c1-4-5-8(2)6-10(11)9(3)7-12/h4-6H,1-3H3/b5-4-,8-6-,10-9- |
| InChIKey | HOEYEUIZRGATIM-OGYSBWKUSA-N |
| XLogP | 3.28 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|