C13H24N2 — CID 146499210
[(5R)-3-(cyclopropen-1-yl)-2,3,4,5-tetramethylcyclohexyl]hydrazine (PubChem CID 146499210) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is [(5R)-3-(cyclopropen-1-yl)-2,3,4,5-tetramethylcyclohexyl]hydrazine.
| Compound Name | [(5R)-3-(cyclopropen-1-yl)-2,3,4,5-tetramethylcyclohexyl]hydrazine |
|---|---|
| PubChem CID | 146499210 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | [(5R)-3-(cyclopropen-1-yl)-2,3,4,5-tetramethylcyclohexyl]hydrazine |
| SMILES | CC1C(NN)C[C@@H](C)C(C)C1(C)C1=CC1 |
| InChI | InChI=1S/C13H24N2/c1-8-7-12(15-14)10(3)13(4,9(8)2)11-5-6-11/h5,8-10,12,15H,6-7,14H2,1-4H3/t8-,9?,10?,12?,13?/m1/s1 |
| InChIKey | LRDXPPJHFHKFQA-ZZYCMBSNSA-N |
| XLogP | 2.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|