C20H22N4 — CID 146499241
3,7-dimethyl-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinolin-8-amine (PubChem CID 146499241) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 3,7-dimethyl-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinolin-8-amine.
| Compound Name | 3,7-dimethyl-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinolin-8-amine |
|---|---|
| PubChem CID | 146499241 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3,7-dimethyl-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinolin-8-amine |
| SMILES | Cc1cc2cc(-c3cnc4c(c3C)NCCC4)c(C)c(N)c2cn1 |
| InChI | InChI=1S/C20H22N4/c1-11-7-14-8-15(12(2)19(21)17(14)10-23-11)16-9-24-18-5-4-6-22-20(18)13(16)3/h7-10,22H,4-6,21H2,1-3H3 |
| InChIKey | LXTHANMARUCLHB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|