C33H34N2O2 — CID 146499495
2-[6-cyclopentyloxy-4-(1,2-dihydrochrysen-6-yl)-1,2,3,4-tetrahydropyrimidin-2-yl]cyclohexa-1,5-dien-1-ol (PubChem CID 146499495) has the molecular formula C33H34N2O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 2-[6-cyclopentyloxy-4-(1,2-dihydrochrysen-6-yl)-1,2,3,4-tetrahydropyrimidin-2-yl]cyclohexa-1,5-dien-1-ol.
| Compound Name | 2-[6-cyclopentyloxy-4-(1,2-dihydrochrysen-6-yl)-1,2,3,4-tetrahydropyrimidin-2-yl]cyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 146499495 |
| Molecular Formula | C33H34N2O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 2-[6-cyclopentyloxy-4-(1,2-dihydrochrysen-6-yl)-1,2,3,4-tetrahydropyrimidin-2-yl]cyclohexa-1,5-dien-1-ol |
| SMILES | OC1=C(C2NC(OC3CCCC3)=CC(c3cc4c5c(ccc4c4ccccc34)CCC=C5)N2)CCC=C1 |
| InChI | InChI=1S/C33H34N2O2/c36-31-16-8-7-15-27(31)33-34-30(20-32(35-33)37-22-10-2-3-11-22)29-19-28-23-12-4-1-9-21(23)17-18-26(28)24-13-5-6-14-25(24)29/h4-6,8,12-14,16-20,22,30,33-36H,1-3,7,9-11,15H2 |
| InChIKey | ISPYPLCGEOLGIC-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|