C18H22FNO4 — CID 146500365
[1-(4-methoxyphenyl)cyclopentanecarbonyl] (2S)-2-fluoropyrrolidine-2-carboxylate (PubChem CID 146500365) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)cyclopentanecarbonyl] (2S)-2-fluoropyrrolidine-2-carboxylate.
| Compound Name | [1-(4-methoxyphenyl)cyclopentanecarbonyl] (2S)-2-fluoropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 146500365 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [1-(4-methoxyphenyl)cyclopentanecarbonyl] (2S)-2-fluoropyrrolidine-2-carboxylate |
| SMILES | COc1ccc(C2(C(=O)OC(=O)[C@@]3(F)CCCN3)CCCC2)cc1 |
| InChI | InChI=1S/C18H22FNO4/c1-23-14-7-5-13(6-8-14)17(9-2-3-10-17)15(21)24-16(22)18(19)11-4-12-20-18/h5-8,20H,2-4,9-12H2,1H3/t18-/m1/s1 |
| InChIKey | LUTCQCUNVGZGHE-GOSISDBHSA-N |
| XLogP | 2.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|