C27H32F3N5O9S2 — CID 146500462
(2R,4R)-1-[4,4-difluoro-1-(4-methoxyphenyl)cyclohexanecarbonyl]-4-fluoro-N-(1H-pyrazolo[4,5-b]pyridin-5-yl)pyrrolidine-2-carboxamide;ethane-1,2-disulfonic acid (PubChem CID 146500462) has the molecular formula C27H32F3N5O9S2 and a molecular weight of 691.71 g/mol. Its IUPAC name is (2R,4R)-1-[4,4-difluoro-1-(4-methoxyphenyl)cyclohexanecarbonyl]-4-fluoro-N-(1H-pyrazolo[4,5-b]pyridin-5-yl)pyrrolidine-2-carboxamide;ethane-1,2-disulfonic acid.
| Compound Name | (2R,4R)-1-[4,4-difluoro-1-(4-methoxyphenyl)cyclohexanecarbonyl]-4-fluoro-N-(1H-pyrazolo[4,5-b]pyridin-5-yl)pyrrolidine-2-carboxamide;ethane-1,2-disulfonic acid |
|---|---|
| PubChem CID | 146500462 |
| Molecular Formula | C27H32F3N5O9S2 |
| Molecular Weight | 691.71 g/mol |
| Exact Mass | 691.16 |
| IUPAC Name | (2R,4R)-1-[4,4-difluoro-1-(4-methoxyphenyl)cyclohexanecarbonyl]-4-fluoro-N-(1H-pyrazolo[4,5-b]pyridin-5-yl)pyrrolidine-2-carboxamide;ethane-1,2-disulfonic acid |
| SMILES | COc1ccc(C2(C(=O)N3C[C@H](F)C[C@@H]3C(=O)Nc3ccc4[nH]ncc4n3)CCC(F)(F)CC2)cc1.O=S(=O)(O)CCS(=O)(=O)O |
| InChI | InChI=1S/C25H26F3N5O3.C2H6O6S2/c1-36-17-4-2-15(3-5-17)24(8-10-25(27,28)11-9-24)23(35)33-14-16(26)12-20(33)22(34)31-21-7-6-18-19(30-21)13-29-32-18;3-9(4,5)1-2-10(6,7)8/h2-7,13,16,20H,8-12,14H2,1H3,(H,29,32)(H,30,31,34);1-2H2,(H,3,4,5)(H,6,7,8)/t16-,20-;/m1./s1 |
| InChIKey | MXGQRIDHAPJDHO-KYSFMIDTSA-N |
| XLogP | 2.75 |
| TPSA | 208.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|