C25H24F5N5O3 — CID 146500463
(2R,4R)-1-[1-(3,5-difluoro-4-methoxyphenyl)-4,4-difluorocyclohexanecarbonyl]-4-fluoro-N-(1H-pyrazolo[4,5-b]pyridin-5-yl)pyrrolidine-2-carboxamide (PubChem CID 146500463) has the molecular formula C25H24F5N5O3 and a molecular weight of 537.49 g/mol. Its IUPAC name is (2R,4R)-1-[1-(3,5-difluoro-4-methoxyphenyl)-4,4-difluorocyclohexanecarbonyl]-4-fluoro-N-(1H-pyrazolo[4,5-b]pyridin-5-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-1-[1-(3,5-difluoro-4-methoxyphenyl)-4,4-difluorocyclohexanecarbonyl]-4-fluoro-N-(1H-pyrazolo[4,5-b]pyridin-5-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146500463 |
| Molecular Formula | C25H24F5N5O3 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | (2R,4R)-1-[1-(3,5-difluoro-4-methoxyphenyl)-4,4-difluorocyclohexanecarbonyl]-4-fluoro-N-(1H-pyrazolo[4,5-b]pyridin-5-yl)pyrrolidine-2-carboxamide |
| SMILES | COc1c(F)cc(C2(C(=O)N3C[C@H](F)C[C@@H]3C(=O)Nc3ccc4[nH]ncc4n3)CCC(F)(F)CC2)cc1F |
| InChI | InChI=1S/C25H24F5N5O3/c1-38-21-15(27)8-13(9-16(21)28)24(4-6-25(29,30)7-5-24)23(37)35-12-14(26)10-19(35)22(36)33-20-3-2-17-18(32-20)11-31-34-17/h2-3,8-9,11,14,19H,4-7,10,12H2,1H3,(H,31,34)(H,32,33,36)/t14-,19-/m1/s1 |
| InChIKey | UFEKXQUEHFRBOH-AUUYWEPGSA-N |
| XLogP | 4.27 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |