C20H23FN6O2S — CID 146500916
4-amino-6-[3-fluoro-5-[1-piperidin-1-yl-2-(sulfinoamino)ethyl]phenyl]pyrido[3,2-d]pyrimidine (PubChem CID 146500916) has the molecular formula C20H23FN6O2S and a molecular weight of 430.51 g/mol. Its IUPAC name is 4-amino-6-[3-fluoro-5-[1-piperidin-1-yl-2-(sulfinoamino)ethyl]phenyl]pyrido[3,2-d]pyrimidine.
| Compound Name | 4-amino-6-[3-fluoro-5-[1-piperidin-1-yl-2-(sulfinoamino)ethyl]phenyl]pyrido[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 146500916 |
| Molecular Formula | C20H23FN6O2S |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-amino-6-[3-fluoro-5-[1-piperidin-1-yl-2-(sulfinoamino)ethyl]phenyl]pyrido[3,2-d]pyrimidine |
| SMILES | Nc1ncnc2ccc(-c3cc(F)cc(C(CNS(=O)O)N4CCCCC4)c3)nc12 |
| InChI | InChI=1S/C20H23FN6O2S/c21-15-9-13(16-4-5-17-19(26-16)20(22)24-12-23-17)8-14(10-15)18(11-25-30(28)29)27-6-2-1-3-7-27/h4-5,8-10,12,18,25H,1-3,6-7,11H2,(H,28,29)(H2,22,23,24) |
| InChIKey | IHMYFBDGQGRKPN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|