C17H18N4O4S — CID 146501058
1-(4-methoxyphenyl)sulfonyl-N-[(1-methylpyrazol-4-yl)methyl]pyrrole-3-carboxamide (PubChem CID 146501058) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-N-[(1-methylpyrazol-4-yl)methyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-N-[(1-methylpyrazol-4-yl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146501058 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-N-[(1-methylpyrazol-4-yl)methyl]pyrrole-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)n2ccc(C(=O)NCc3cnn(C)c3)c2)cc1 |
| InChI | InChI=1S/C17H18N4O4S/c1-20-11-13(10-19-20)9-18-17(22)14-7-8-21(12-14)26(23,24)16-5-3-15(25-2)4-6-16/h3-8,10-12H,9H2,1-2H3,(H,18,22) |
| InChIKey | XZTBGFCKMYMNLE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |