About 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid
4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid (PubChem CID 146501176) has the molecular formula C23H25N3O3S
and a molecular weight of 423.54 g/mol. Its IUPAC name is 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid |
| PubChem CID | 146501176 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid |
| SMILES | Cc1cc(C(=O)Nc2ccc(C(=O)O)cc2)n(Cc2csc(C3CCCCC3)n2)c1 |
| InChI | InChI=1S/C23H25N3O3S/c1-15-11-20(21(27)24-18-9-7-17(8-10-18)23(28)29)26(12-15)13-19-14-30-22(25-19)16-5-3-2-4-6-16/h7-12,14,16H,2-6,13H2,1H3,(H,24,27)(H,28,29) |
| InChIKey | PJHOCNCEKHEOID-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid?
The IUPAC name of 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid (CID 146501176) is 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid.
What is the SMILES notation for 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid?
The canonical SMILES for 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid is Cc1cc(C(=O)Nc2ccc(C(=O)O)cc2)n(Cc2csc(C3CCCCC3)n2)c1.
What is the InChIKey of 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid?
The InChIKey is PJHOCNCEKHEOID-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O3S/c1-15-11-20(21(27)24-18-9-7-17(8-10-18)23(28)29)26(12-15)13-19-14-30-22(25-19)16-5-3-2-4-6-16/h7-12,14,16H,2-6,13H2,1H3,(H,24,27)(H,28,29).
What are the key properties of 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid?
4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid has a molecular weight of 423.54 g/mol, XLogP of 5.30, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-4-methylpyrrole-2-carbonyl]amino]benzoic acid is sourced from PubChem (CID 146501176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).