About 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid
3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid (PubChem CID 146502080) has the molecular formula C15H24N4O3
and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid.
Molecular Properties
| Compound Name | 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid |
| PubChem CID | 146502080 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid |
| SMILES | CC(C)C(C(=O)O)c1cc(N2CC(N3CCNCC3)C2)no1 |
| InChI | InChI=1S/C15H24N4O3/c1-10(2)14(15(20)21)12-7-13(17-22-12)19-8-11(9-19)18-5-3-16-4-6-18/h7,10-11,14,16H,3-6,8-9H2,1-2H3,(H,20,21) |
| InChIKey | CPUHWLJZECHJAW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid?
The IUPAC name of 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid (CID 146502080) is 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid.
What is the SMILES notation for 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid?
The canonical SMILES for 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid is CC(C)C(C(=O)O)c1cc(N2CC(N3CCNCC3)C2)no1.
What is the InChIKey of 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid?
The InChIKey is CPUHWLJZECHJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O3/c1-10(2)14(15(20)21)12-7-13(17-22-12)19-8-11(9-19)18-5-3-16-4-6-18/h7,10-11,14,16H,3-6,8-9H2,1-2H3,(H,20,21).
What are the key properties of 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid?
3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid has a molecular weight of 308.38 g/mol, XLogP of 0.59, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-[3-(3-piperazin-1-ylazetidin-1-yl)-1,2-oxazol-5-yl]butanoic acid is sourced from PubChem (CID 146502080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).