C25H20FN5O — CID 146502750
(6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-2-pyridazin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 146502750) has the molecular formula C25H20FN5O and a molecular weight of 425.47 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-2-pyridazin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-2-pyridazin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 146502750 |
| Molecular Formula | C25H20FN5O |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-2-pyridazin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4ccnnc4)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C25H20FN5O/c1-14-19-8-7-18-21(17-5-3-4-6-20(17)26)30-24(15-9-10-28-29-13-15)31-23(18)25(19,2)11-16(12-27)22(14)32/h3-6,9-11,13-14,19H,7-8H2,1-2H3/t14-,19-,25-/m1/s1 |
| InChIKey | MDLWSWDFGNXONV-LNMSCABWSA-N |
| XLogP | 4.23 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |