C16H24O7 — CID 146502814
2-hydroxypropane-1,2,3-tricarboxylic acid;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 146502814) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 146502814 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)[C@H]1CC=C(C)CC1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16.C6H8O7/c1-8(2)10-6-4-9(3)5-7-10;7-3(8)1-6(13,5(11)12)2-4(9)10/h4,10H,1,5-7H2,2-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t10-;/m0./s1 |
| InChIKey | UPHTWWMDUXOUOH-PPHPATTJSA-N |
| XLogP | 2.06 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|