C30H30N4O2 — CID 146502844
(6aR,7R,10aS)-4-cyclohexyloxy-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 146502844) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-cyclohexyloxy-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-cyclohexyloxy-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 146502844 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (6aR,7R,10aS)-4-cyclohexyloxy-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4ccnc5ccccc45)nc(OC4CCCCC4)c3CC[C@H]12 |
| InChI | InChI=1S/C30H30N4O2/c1-18-24-13-12-23-27(30(24,2)16-19(17-31)26(18)35)33-28(34-29(23)36-20-8-4-3-5-9-20)22-14-15-32-25-11-7-6-10-21(22)25/h6-7,10-11,14-16,18,20,24H,3-5,8-9,12-13H2,1-2H3/t18-,24-,30-/m1/s1 |
| InChIKey | VDILPARYMUFCPB-DDTSJLOESA-N |
| XLogP | 5.89 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |