C26H22FN5O — CID 146502884
(6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(6-methylpyrimidin-4-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 146502884) has the molecular formula C26H22FN5O and a molecular weight of 439.49 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(6-methylpyrimidin-4-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(6-methylpyrimidin-4-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 146502884 |
| Molecular Formula | C26H22FN5O |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(6-methylpyrimidin-4-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | Cc1cc(-c2nc(-c3ccccc3F)c3c(n2)[C@]2(C)C=C(C#N)C(=O)[C@H](C)[C@H]2CC3)ncn1 |
| InChI | InChI=1S/C26H22FN5O/c1-14-10-21(30-13-29-14)25-31-22(17-6-4-5-7-20(17)27)18-8-9-19-15(2)23(33)16(12-28)11-26(19,3)24(18)32-25/h4-7,10-11,13,15,19H,8-9H2,1-3H3/t15-,19-,26-/m1/s1 |
| InChIKey | YGROWZUIJRMRKC-XYHRYAGJSA-N |
| XLogP | 4.54 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |