C13H21O3P — CID 146502935
(3E,5Z)-4-(diethoxyphosphorylmethyl)octa-1,3,5,7-tetraene (PubChem CID 146502935) has the molecular formula C13H21O3P and a molecular weight of 256.28 g/mol. Its IUPAC name is (3E,5Z)-4-(diethoxyphosphorylmethyl)octa-1,3,5,7-tetraene.
| Compound Name | (3E,5Z)-4-(diethoxyphosphorylmethyl)octa-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 146502935 |
| Molecular Formula | C13H21O3P |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (3E,5Z)-4-(diethoxyphosphorylmethyl)octa-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(=C/C=C)CP(=O)(OCC)OCC |
| InChI | InChI=1S/C13H21O3P/c1-5-9-11-13(10-6-2)12-17(14,15-7-3)16-8-4/h5-6,9-11H,1-2,7-8,12H2,3-4H3/b11-9-,13-10+ |
| InChIKey | IUHZRIPWEWVETE-SZJZEYKYSA-N |
| XLogP | 4.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|