C20H22F2O6 — CID 146503107
[(2R,4R,5R)-3,3-difluoro-2,5,6-trihydroxy-4-phenylmethoxyhexyl] benzoate (PubChem CID 146503107) has the molecular formula C20H22F2O6 and a molecular weight of 396.39 g/mol. Its IUPAC name is [(2R,4R,5R)-3,3-difluoro-2,5,6-trihydroxy-4-phenylmethoxyhexyl] benzoate.
| Compound Name | [(2R,4R,5R)-3,3-difluoro-2,5,6-trihydroxy-4-phenylmethoxyhexyl] benzoate |
|---|---|
| PubChem CID | 146503107 |
| Molecular Formula | C20H22F2O6 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [(2R,4R,5R)-3,3-difluoro-2,5,6-trihydroxy-4-phenylmethoxyhexyl] benzoate |
| SMILES | O=C(OC[C@@H](O)C(F)(F)[C@H](OCc1ccccc1)[C@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C20H22F2O6/c21-20(22,17(25)13-28-19(26)15-9-5-2-6-10-15)18(16(24)11-23)27-12-14-7-3-1-4-8-14/h1-10,16-18,23-25H,11-13H2/t16-,17-,18-/m1/s1 |
| InChIKey | HPGMCRLJFLNCEP-KZNAEPCWSA-N |
| XLogP | 1.78 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |