C23H22Cl2N2O4 — CID 146503219
3,4-dichloro-N-[2-[2-(6-methoxyquinolin-4-yl)ethyl]-1,3-dioxan-5-yl]benzamide (PubChem CID 146503219) has the molecular formula C23H22Cl2N2O4 and a molecular weight of 461.35 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[2-(6-methoxyquinolin-4-yl)ethyl]-1,3-dioxan-5-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[2-(6-methoxyquinolin-4-yl)ethyl]-1,3-dioxan-5-yl]benzamide |
|---|---|
| PubChem CID | 146503219 |
| Molecular Formula | C23H22Cl2N2O4 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 3,4-dichloro-N-[2-[2-(6-methoxyquinolin-4-yl)ethyl]-1,3-dioxan-5-yl]benzamide |
| SMILES | COc1ccc2nccc(CCC3OCC(NC(=O)c4ccc(Cl)c(Cl)c4)CO3)c2c1 |
| InChI | InChI=1S/C23H22Cl2N2O4/c1-29-17-4-6-21-18(11-17)14(8-9-26-21)3-7-22-30-12-16(13-31-22)27-23(28)15-2-5-19(24)20(25)10-15/h2,4-6,8-11,16,22H,3,7,12-13H2,1H3,(H,27,28) |
| InChIKey | ZCCQPOJAEYPDRY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |