About 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol
1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol (PubChem CID 146503385) has the molecular formula C16H20F2OS
and a molecular weight of 298.40 g/mol. Its IUPAC name is 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol.
Molecular Properties
| Compound Name | 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol |
| PubChem CID | 146503385 |
| Molecular Formula | C16H20F2OS |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol |
| SMILES | CCCCCC(O)C#CC(F)(F)SCc1ccccc1 |
| InChI | InChI=1S/C16H20F2OS/c1-2-3-5-10-15(19)11-12-16(17,18)20-13-14-8-6-4-7-9-14/h4,6-9,15,19H,2-3,5,10,13H2,1H3 |
| InChIKey | YZEMYJLDSGWZLT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol?
The IUPAC name of 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol (CID 146503385) is 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol.
What is the SMILES notation for 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol?
The canonical SMILES for 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol is CCCCCC(O)C#CC(F)(F)SCc1ccccc1.
What is the InChIKey of 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol?
The InChIKey is YZEMYJLDSGWZLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F2OS/c1-2-3-5-10-15(19)11-12-16(17,18)20-13-14-8-6-4-7-9-14/h4,6-9,15,19H,2-3,5,10,13H2,1H3.
What are the key properties of 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol?
1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol has a molecular weight of 298.40 g/mol, XLogP of 4.46, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylsulfanyl-1,1-difluoronon-2-yn-4-ol is sourced from PubChem (CID 146503385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).