About 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole
2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole (PubChem CID 14650373) has the molecular formula C18H17N5O2S
and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole |
| PubChem CID | 14650373 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(COc3ccc(OCCCc4nn[nH]n4)cc3)nc2c1 |
| InChI | InChI=1S/C18H17N5O2S/c1-2-5-16-15(4-1)19-18(26-16)12-25-14-9-7-13(8-10-14)24-11-3-6-17-20-22-23-21-17/h1-2,4-5,7-10H,3,6,11-12H2,(H,20,21,22,23) |
| InChIKey | WDPPBFVYYDSIJZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole?
The IUPAC name of 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole (CID 14650373) is 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole?
The canonical SMILES for 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole is c1ccc2sc(COc3ccc(OCCCc4nn[nH]n4)cc3)nc2c1.
What is the InChIKey of 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole?
The InChIKey is WDPPBFVYYDSIJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O2S/c1-2-5-16-15(4-1)19-18(26-16)12-25-14-9-7-13(8-10-14)24-11-3-6-17-20-22-23-21-17/h1-2,4-5,7-10H,3,6,11-12H2,(H,20,21,22,23).
What are the key properties of 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole?
2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole has a molecular weight of 367.43 g/mol, XLogP of 3.40, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[3-(2H-tetrazol-5-yl)propoxy]phenoxy]methyl]-1,3-benzothiazole is sourced from PubChem (CID 14650373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).