C24H36O3 — CID 146504473
4,5,6,7-tetratert-butyl-2-benzofuran-1,3-dione (PubChem CID 146504473) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is 4,5,6,7-tetratert-butyl-2-benzofuran-1,3-dione.
| Compound Name | 4,5,6,7-tetratert-butyl-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 146504473 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 4,5,6,7-tetratert-butyl-2-benzofuran-1,3-dione |
| SMILES | CC(C)(C)c1c2c(c(C(C)(C)C)c(C(C)(C)C)c1C(C)(C)C)C(=O)OC2=O |
| InChI | InChI=1S/C24H36O3/c1-21(2,3)15-13-14(20(26)27-19(13)25)16(22(4,5)6)18(24(10,11)12)17(15)23(7,8)9/h1-12H3 |
| InChIKey | XYFQRRXGPHCXPF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|