About 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole
6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole (PubChem CID 146504695) has the molecular formula C13H10FNO
and a molecular weight of 215.23 g/mol. Its IUPAC name is 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole |
| PubChem CID | 146504695 |
| Molecular Formula | C13H10FNO |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole |
| SMILES | Fc1ccc2c(c1)OC(c1ccccc1)N2 |
| InChI | InChI=1S/C13H10FNO/c14-10-6-7-11-12(8-10)16-13(15-11)9-4-2-1-3-5-9/h1-8,13,15H |
| InChIKey | PARQGAUYBTYZIC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole?
The IUPAC name of 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole (CID 146504695) is 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole.
What is the SMILES notation for 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole?
The canonical SMILES for 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole is Fc1ccc2c(c1)OC(c1ccccc1)N2.
What is the InChIKey of 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole?
The InChIKey is PARQGAUYBTYZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FNO/c14-10-6-7-11-12(8-10)16-13(15-11)9-4-2-1-3-5-9/h1-8,13,15H.
What are the key properties of 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole?
6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole has a molecular weight of 215.23 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-phenyl-2,3-dihydro-1,3-benzoxazole is sourced from PubChem (CID 146504695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).