C14H14N2 — CID 146504738
3-methyl-6-phenyl-1,2-dihydrobenzimidazole (PubChem CID 146504738) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-methyl-6-phenyl-1,2-dihydrobenzimidazole.
| Compound Name | 3-methyl-6-phenyl-1,2-dihydrobenzimidazole |
|---|---|
| PubChem CID | 146504738 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3-methyl-6-phenyl-1,2-dihydrobenzimidazole |
| SMILES | CN1CNc2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C14H14N2/c1-16-10-15-13-9-12(7-8-14(13)16)11-5-3-2-4-6-11/h2-9,15H,10H2,1H3 |
| InChIKey | WIHHHSQVFDTNFP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |