C21H28O7S — CID 146504957
2-[(2R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]prop-2-enal (PubChem CID 146504957) has the molecular formula C21H28O7S and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-[(2R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]prop-2-enal.
| Compound Name | 2-[(2R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 146504957 |
| Molecular Formula | C21H28O7S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[(2R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]prop-2-enal |
| SMILES | C=C(C=O)[C@@H]1O[C@H](CC2COC(C)(C)O2)C(OC)C1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H28O7S/c1-14(11-22)19-17(13-29(23,24)16-8-6-5-7-9-16)20(25-4)18(27-19)10-15-12-26-21(2,3)28-15/h5-9,11,15,17-20H,1,10,12-13H2,2-4H3/t15?,17?,18-,19+,20?/m1/s1 |
| InChIKey | XJASPJXGYRHZMH-CHQWBLCOSA-N |
| XLogP | 2.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|