C26H28Cl2O4 — CID 146505219
4,5-dichloro-1,2,3-tris(4-methylphenoxy)pentan-1-ol (PubChem CID 146505219) has the molecular formula C26H28Cl2O4 and a molecular weight of 475.41 g/mol. Its IUPAC name is 4,5-dichloro-1,2,3-tris(4-methylphenoxy)pentan-1-ol.
| Compound Name | 4,5-dichloro-1,2,3-tris(4-methylphenoxy)pentan-1-ol |
|---|---|
| PubChem CID | 146505219 |
| Molecular Formula | C26H28Cl2O4 |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 4,5-dichloro-1,2,3-tris(4-methylphenoxy)pentan-1-ol |
| SMILES | Cc1ccc(OC(O)C(Oc2ccc(C)cc2)C(Oc2ccc(C)cc2)C(Cl)CCl)cc1 |
| InChI | InChI=1S/C26H28Cl2O4/c1-17-4-10-20(11-5-17)30-24(23(28)16-27)25(31-21-12-6-18(2)7-13-21)26(29)32-22-14-8-19(3)9-15-22/h4-15,23-26,29H,16H2,1-3H3 |
| InChIKey | HPAJWXXIWZPUET-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|