C30H33NO6 — CID 146505659
(3S)-2-(2-butoxy-2-phenylacetyl)-6-methoxy-5-phenylmethoxy-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 146505659) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is (3S)-2-(2-butoxy-2-phenylacetyl)-6-methoxy-5-phenylmethoxy-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | (3S)-2-(2-butoxy-2-phenylacetyl)-6-methoxy-5-phenylmethoxy-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 146505659 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | (3S)-2-(2-butoxy-2-phenylacetyl)-6-methoxy-5-phenylmethoxy-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | CCCCOC(C(=O)N1Cc2ccc(OC)c(OCc3ccccc3)c2C[C@H]1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C30H33NO6/c1-3-4-17-36-27(22-13-9-6-10-14-22)29(32)31-19-23-15-16-26(35-2)28(24(23)18-25(31)30(33)34)37-20-21-11-7-5-8-12-21/h5-16,25,27H,3-4,17-20H2,1-2H3,(H,33,34)/t25-,27?/m0/s1 |
| InChIKey | SVCZBSNQCDVRSD-PVCWFJFTSA-N |
| XLogP | 5.17 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|