C54H38N3O2P — CID 146505830
2-dibenzofuran-3-yl-4-[3-(3-dimethylphosphorylphenyl)phenyl]-6-(9,9-diphenylfluoren-4-yl)-1,3,5-triazine (PubChem CID 146505830) has the molecular formula C54H38N3O2P and a molecular weight of 791.89 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-[3-(3-dimethylphosphorylphenyl)phenyl]-6-(9,9-diphenylfluoren-4-yl)-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-[3-(3-dimethylphosphorylphenyl)phenyl]-6-(9,9-diphenylfluoren-4-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 146505830 |
| Molecular Formula | C54H38N3O2P |
| Molecular Weight | 791.89 g/mol |
| Exact Mass | 791.27 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-[3-(3-dimethylphosphorylphenyl)phenyl]-6-(9,9-diphenylfluoren-4-yl)-1,3,5-triazine |
| SMILES | CP(C)(=O)c1cccc(-c2cccc(-c3nc(-c4ccc5c(c4)oc4ccccc45)nc(-c4cccc5c4-c4ccccc4C5(c4ccccc4)c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C54H38N3O2P/c1-60(2,58)41-23-14-17-36(33-41)35-16-13-18-37(32-35)51-55-52(38-30-31-43-42-24-10-12-29-48(42)59-49(43)34-38)57-53(56-51)45-26-15-28-47-50(45)44-25-9-11-27-46(44)54(47,39-19-5-3-6-20-39)40-21-7-4-8-22-40/h3-34H,1-2H3 |
| InChIKey | YZOJCFCSUPPLAP-UHFFFAOYSA-N |
| XLogP | 13.05 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.89 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|